Annulatin Chemical structure of annulatin |
| Names |
| IUPAC name 3′,4′,5,5′,7-Pentahydroxy-3-methoxyflavone |
Systematic IUPAC name 5,7-Dihydroxy-3-methoxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one |
| Other names Myricetin 3-Methylether |
| Identifiers |
| | |
| | |
| ChemSpider | |
| | |
| UNII | |
| | |
InChI=1S/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 YKey: XWTLYULBWZQAAZ-UHFFFAOYSA-N YInChI=1/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 Key: XWTLYULBWZQAAZ-UHFFFAOYAS |
COc1c(=O)c2c(cc(cc2oc1c3cc(c(c(c3)O)O)O)O)O |
| Properties |
| | C16H12O8 |
| Molar mass | 332.264 g·mol−1 |
| Density | 1.807 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Annulatin is an O-methylated flavonol found in the roots of Pteroxygonum giraldii.[1]
References
- ^ Li, Bao-Lin; Yang, Zhan-Jun; Jiang, Lin-Ling; Zhang, Xi-Quan; Gu, Hong-Mei; Wang, Hui-Chun; Tian, Xian-Hua (2009). "ChemInform Abstract: Antioxidant Flavone Glycosides from the Root of Pteroxygonum giraldii". ChemInform. 40 (49). doi:10.1002/chin.200949203.
Flavonols and their conjugates |
|---|
| Backbone | |
|---|
| Flavonols | | Aglycones | |
|---|
| Conjugates | | Glycosides of herbacetin | |
|---|
| Glycosides of kaempferol | - Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| Glycosides of myricetin | |
|---|
| Conjugates of quercetin | |
|---|
|
|---|
|
|---|
| O-Methylated flavonols | | Aglycones | |
|---|
| Glycosides | | of isorhamnetin | - Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other | - Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| Derivative flavonols | | Aglycones | - Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| Pyranoflavonols | |
|---|
| Furanoflavonols | |
|---|
| Semisynthetic | |
|---|