Droxicam|  | 
|  | 
|
| ATC code |  | 
|---|
|
|   2H,5H-1,3-Oxazino(5,6-c)(1,2)benzothiazine-2,4(3H)-dione, 5-methyl-3-(2-pyridinyl)-, 6,6-dioxide
 | 
| CAS Number |  | 
|---|
| PubChem CID |  | 
|---|
| ChemSpider |  | 
|---|
| UNII |  | 
|---|
| KEGG |  | 
|---|
| ChEBI |  | 
|---|
| ChEMBL |  | 
|---|
| CompTox Dashboard (EPA) |  | 
|---|
|
| Formula | C16H11N3O5S | 
|---|
| Molar mass | 357.34 g·mol−1 | 
|---|
| 3D model (JSmol) |  | 
|---|
|   CN1c2c(oc(=O)n(c2=O)c3ccccn3)-c4ccccc4S1(=O)=O
 | 
|   InChI=1S/C16H11N3O5S/c1-18-13-14(10-6-2-3-7-11(10)25(18,22)23)24-16(21)19(15(13)20)12-8-4-5-9-17-12/h2-9H,1H3  YKey:OEHFRZLKGRKFAS-UHFFFAOYSA-N  Y
 | 
 Droxicam is a non-steroidal anti-inflammatory drug of the oxicam class. A prodrug of piroxicam, it is used for the relief of pain and inflammation in musculoskeletal disorders such as rheumatoid arthritis and osteoarthritis.[1] 
 Synthesis
 .svg.png) 
When heated, phenyl pyridin-2-ylcarbamate (1) decomposes to 2-isocyanatopyridine (2) which reacts with the heterocyclic compound (3) to give droxicam.[2][3][4] 
 References
   - ^ Jané F, Rodríguez de la Serna A (1991). "Droxicam: a pharmacological and clinical review of a new NSAID". European Journal of Rheumatology and Inflammation. 11 (4): 3–9. PMID 1365488. 
- ^ US patent 4563452, Jose M. Ribalta-Baro and Jordi F. Rigola-Constansa, "Benzothiazine derivatives and their applications as medicinal products or as synthesis intermediates for medicinal products", issued 1992-07-21,  assigned to Laboratorios del Dr Esteve SA  
- ^ "Droxicam". Thieme. Retrieved 2024-07-04. 
- ^ "Droxicam". chemdrug.com. Retrieved 2024-07-04. 
   |  | 
|---|
| Receptor (ligands)
 | | DP (D2)Tooltip Prostaglandin D2 receptor | | DP1Tooltip Prostaglandin D2 receptor 1 |  | 
|---|
 | DP2Tooltip Prostaglandin D2 receptor 2 |  | 
|---|
 | 
|---|
 | EP (E2)Tooltip Prostaglandin E2 receptor | | EP1Tooltip Prostaglandin EP1 receptor |   Antagonists: AH-6809ONO-8130SC-19220SC-51089SC-51322
 | 
|---|
 | EP2Tooltip Prostaglandin EP2 receptor |   Antagonists: AH-6809PF-04418948TG 4-155
 | 
|---|
 | EP3Tooltip Prostaglandin EP3 receptor |  | 
|---|
 | EP4Tooltip Prostaglandin EP4 receptor |   Antagonists: GrapiprantGW-627368L-161982ONO-AE3-208
 | 
|---|
 | Unsorted |  | 
|---|
 | 
|---|
 | FP (F2α)Tooltip Prostaglandin F receptor |  | 
|---|
 | IP (I2)Tooltip Prostacyclin receptor |  | 
|---|
 | TP (TXA2)Tooltip Thromboxane receptor |  | 
|---|
 | Unsorted |  ArbaprostilAtaprostCiprosteneClinprostCobiprostoneDelprostenateDeprostilDimoxaprostDoxaprostEcraprostEganoprostEnisoprostEptaloprostEsuberaprostEtiprostonFenprostaleneFlunoprostFroxiprostLanprostonLimaprostLuprostiolMeteneprostMexiprostilNaxaprosteneNileprostNocloprostOrnoprostilOxoprostolPenprostenePimilprostPiriprostPosaraprostProstaleneRioprostilRivenprostRosaprostolSpiriprostilTiaprostTilsuprostTiprostanideTrimoprostilViprostol
 | 
|---|
 | 
|---|
| Enzyme (inhibitors)
 | | COX (PTGS)
 |  | 
|---|
 | PGD2STooltip Prostaglandin D synthase |  | 
|---|
 | PGESTooltip Prostaglandin E synthase | HQL-79 | 
|---|
 | PGFSTooltip Prostaglandin F synthase |  | 
|---|
 | PGI2STooltip Prostacyclin synthase |  | 
|---|
 | TXASTooltip Thromboxane A synthase |  | 
|---|
 | 
|---|
| Others |  | 
|---|
|  See alsoReceptor/signaling modulatorsLeukotriene signaling modulators
 |