Fluoride phosphate
The fluoride phosphates or phosphate fluorides are inorganic double salts that contain both fluoride and phosphate anions. In mineralogy, Hey's Chemical Index of Minerals groups these as 22.1. The Nickel-Strunz grouping is 8.BN.
Related mixed anion compounds are the chloride phosphates, the fluoride arsenates and fluoride vanadates.
They are distinct from the fluorophosphates: monofluorophosphate, difluorophosphate and hexafluorophosphate which have fluorine bonds to the phosphorus.
Minerals
| name | formula | ratio PO4:F | formula weight | crystal system | space group | unit cell | volume | density | refractive index | comment | reference |
|---|---|---|---|---|---|---|---|---|---|---|---|
| Althausite | Mg4(PO4)2(OH,O)(F,☐) | 2:~1 | Orthorhombic | Pnma | a = 8.258 b = 6.054, c = 14.383 | 719.06 | 2.97 | Biaxial (+) nα = 1.588 nβ = 1.592 nγ = 1.598 2V: measured: 70° , calculated: 80° Max birefringence: δ = 0.010 | [1] | ||
| Amblygonite | LiAl(PO4)F | 1:1 | Triclinic | P1 | a = 6.644 b = 7.744 c = 6.91 α = 90.35°, β = 117.33°, γ = 91.01° Z=4 | 315.75 | 3.04-3.11 | Biaxial (-) nα = 1.577 - 1.591 nβ = 1.592 - 1.605 nγ = 1.596 - 1.613 2V: Measured: 107° to 129.5° Birefringence: 0.020 | [2] | ||
| aravaite | Ba2Ca18(SiO4)6(PO4)3(CO3)F3O | 3:3 | trigonal | R3m | a = 7.1255, c = 66.290 Z=3 | 2914.8 | [3] | ||||
| Arctite | Na2Ca4(PO4)3F | 3:1 | Trigonal | R3m | a = 7.078 c = 41.203 Z=6 | 1,787.64 | 3.13 | Uniaxial (-) nω = 1.578 nε = 1.577 Birefringence: 0.001 | [4] | ||
| Ariegilatite | BaCa12(SiO4)4(PO4)2F2O | Trigonal | R3m | a = 7.1551 c = 41.303 | 1381.2 | Uniaxial (-) nω = 1.650 nε = 1.647 Max Birefringence: δ = 0.003 | [5] | ||||
| Babefphite | BaBePO4(F,OH) | 1:~1 | Tetragonal | Uniaxial (+) nω = 1.629 nε = 1.632 Max birefringence: δ = 0.003 | [6] | ||||||
| Belovite-(Ce) | NaCeSr3(PO4)3F | 3:1 | Trigonal | P3 | a = 9.692 c = 7.201 | 585.80 | 4.19 | Uniaxial (-) nω = 1.653 - 1.660 nε = 1.634 - 1.640 Birefringence: 0.015 | [7] | ||
| Belovite-(La) | NaLaSr3(PO4)3F | 3:1 | Trigonal | P3 | a = 9.647 c = 7.17 | 577.88 | 4.19 | Uniaxial (-) nω = 1.653 nε = 1.635 - 1.636 Max birefringence: δ = 0.018 | [8] | ||
| Bøggildite | Na2Sr2Al2PO4F9 | 1:9 | Monoclinic | Biaxial (+) nα = 1.462 nβ = 1.466 nγ = 1.469 2V: 80° Max birefringence:δ = 0.007 | [9] | ||||||
| Carlgieseckeite-(Nd) | NaNdCa3(PO4)3F | Trigonal | P3 | a = 9.4553 c = 6.9825 | 540.62 | 3.91 | [10] | ||||
| Cloncurryite | Cu0.5(VO)0.5Al2(PO4)2F2 · 5H2O | 2:2 | Monoclinic | P21/b | a = 4.9573 b = 12.1824 c = 18.9749 β = 90.933° Z=4 | 1145.78 | 2.525 | Biaxial (-) nα = 1.548(2) nγ = 1.550(2) 2V: calculated: 56° Max brefringence: δ = 0.002 | [11] | ||
| Deloneite | (Na0.5REE0.25Ca0.25)(Ca0.75REE0.25)Sr1.5(CaNa0.25REE0.25)(PO4)3F0.5(OH)0.5 | Trigonal | P3 | a = 9.51 c = 7.01 Z=2 | 549.05 | 3.92 | Uniaxial (-) nω = 1.682 nε = 1.660 Max birefringence: δ = 0.022 | [12] | |||
| Fluellite | Al2(PO4)F2(OH) · 7H2O | Orthorhombic | Fddd | a = 11.22 b = 21.15 c = 8.54 | 2,027 | 2.139 - 2.17 | Biaxial (+) nα = 1.473 - 1.490 nβ = 1.490 - 1.496 nγ = 1.506 - 1.511 Max birefringence: δ = 0.033 | [13] | |||
| Fluorapatite | Ca5(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.3973 c = 6.8782 | 526.03 | 3.1-3.25 | Uniaxial (-) nω = 1.631 - 1.650 nε = 1.627 - 1.646 Birefringence: 0.004 | [14] | ||
| Fluorcaphite | SrCaCa3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.485 c = 7.000 Z=2 | 545.39 | Uniaxial (-) nω = 1.649 nε = 1.637 Max birefringence: δ = 0.012 | [15] | |||
| Fluorphosphohedyphane | Ca2Pb3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.640, c = 7.012 Z=2 | 564.4 | 5.445 | Uniaxial (-) nω = 1.836 nε = 1.824 Max birefringence: δ = 0.012 | [16] | ||
| Fluorstrophite | SrCaSr3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.565 c = 7.115 Z=2 | 563.74 | Uniaxial (-) nω = 1.651 nε = 1.637 Max birefringence: δ = 0.014 | [17] | |||
| Francolite | |||||||||||
| Herderite | CaBe(PO4)F | Monoclinic | a = 4.81, b = 7.7 c = 9.82 β = 90.1° | 363.7 | 3.02 | Biaxial (-) nα = 1.556 - 1.592 nβ = 1.578 - 1.610 nγ = 1.589 - 1.620 2V: calculated: 70° Max birefringence: δ = 0.033 | [18] | ||||
| Iangreyite | Ca2Al7(PO4)2(PO3OH)2(OH,F)15 · 8H2O | 4:~15 | Trigonal | P3 2 1 | a = 6.988 c = 16.707 | 706.5 | [19] | ||||
| Isokite | CaMg(PO4)F | Monoclinic | B2/b | a = 6.52 b = 8.75 c = 7.51 β = 121.47° | 365.4 | 3.15-3.27 | Biaxial (+) nα = 1.590 nβ = 1.595 nγ = 1.615 2V: ,easured: 51° Max birefringence: δ = 0.025 | [20] | |||
| Kingite | Al3(PO4)2F2(OH) · 7H2O | 2:2 | Triclinic | a = 9.15 b = 10 c = 7.24 α = 98.6°, β = 93.6°, γ = 93.2° | Biaxial | [21] | |||||
| Kuannersuite-(Ce) | NaCeBa3(PO4)3F0.5Cl0.5 | 6:1 | Trigonal | P3 | a = 9.909 c = 7.402 | 629.42 | 4.51 | [22] | |||
| Lacroixite | NaAl(PO4)F | 1:1 | Monoclinic | B2/b | a = 6.414 b = 8.207 c = 6.885 β = 115.47° | 327.20 | 3.126 - 3.29 | Biaxial (-) nα = 1.546 nβ = 1.563 nγ = 1.580 2V: measured: 89° Birefringence: 0.034 | [23] | ||
| Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O | 4:1 | Triclinic | a = 10.05 b = 11.56 c = 6.88 α = 105.84°, β = 93.66°, γ = 106.47° | 728.7 | Biaxial (-) nα = 1.522 nβ = 1.531 nγ = 1.534 2V: measured: 55° to 59.7°, calculated: 58° Max birefringence:δ = 0.012 | [24] | ||||
| Minyulite | KAl2(PO4)2(OH,F) · 4H2O | 2:~1 | Orthorhombic | Pba2 | a = 9.34 b = 9.74 c = 5.52 | 502 | 2.47 | Biaxial (+) nα = 1.531 nβ = 1.534 nγ = 1.538 2V: measured: 70° , calculated: 82° Max birefringence: δ = 0.007 | [25] | ||
| Miyahisaite | (Sr,Ca)2Ba3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.921, c = 7.469 Z=2 | 636.7 | 4.511 | [26] | |||
| Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O | 2:4 | Monoclinic | 2.94 | Biaxial (-) nα = 1.551 nβ = 1.563 nγ = 1.565 2V: measured: 43° , calculated: 44° Max birefringence: δ = 0.014 | [27] | |||||
| Nacaphite | Na2Ca(PO4)F | Monoclinic | P21/b | a = 13.318 b = 7.0964 c = 10.6490 β = 113.526° Z=8 | 922.81 | Biaxial (-) nα = 1.508 nβ = 1.515 nγ = 1.520 2V: 80° Max birefringence: δ = 0.012 | [28] | ||||
| natrophosphate | Na7(PO4)2F.19H2O | 2:1 | Isometric | Fd3c | a = 27.79 Z=56 | 21,461.78 | 1,71-1.72 | Isotropic | [29][30] | ||
| Nefedovite | Na5Ca4(PO4)4F | 4:1 | Triclinic | a = 5.4 Å, b = 11.64 Å, c = 16.48 Å α = 134.99°, β = 90.04°, γ = 89.96° | 732.60 | Biaxial (+) nα = 1.571 nγ = 1.590 Max birefringence: δ = 0.019 | [31] | ||||
| Nevadaite | (Cu2+,Al,V3+)6Al8(PO4)8F8(OH)2 · 22H2O | 8:8 | Orthorhombic | P21mn | a = 12.123 b = 18.999 c = 4.961 | 2.54 | Biaxial (-) nα = 1.540 nβ = 1.548 nγ = 1.553 2V: measured: 76°, calculated: 76° Max birefringence: δ = 0.013 | [32] | |||
| Panasqueiraite | CaMg(PO4)(OH,F) | 1:~1 | monoclinic | a = 6.53 b = 8.75 c = 6.91 β = 112.33° | 365.2 | 3.27 | Biaxial (+) nα = 1.590 nβ = 1.596 nγ = 1.616 2V: measured: 51° , calculated: 58° Max birefringence: δ = 0.026 | [33] | |||
| Richellite | CaFe3+2(PO4)2(OH,F)2 | 2:~2 | a = 5.18 c = 12.61 | [34] | |||||||
| Stronadelphite | Sr5(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.845 c = 7.383 | 619.72 | Uniaxial (-) nω = 1.630(1) nε = 1.623(1) Max birefringence: δ = 0.007 | [35] | |||
| Triplite | Mn2+2(PO4)F | 1:1 | Monoclinic | P21/b | a = 11.9 b = 6.52 c = 10.09 β = 105.62° | 758.4 | 3.9 | Biaxial (+) nα = 1.650 nβ = 1.660 nγ = 1.680 2V: measured: 70° to 90°, calculated: 72° Max birefringence: δ = 0.030 | [36] | ||
| Väyrynenite | Mn2+Be(PO4)(OH,F) | 1:~1 | Monoclinic | P21/b | a = 5.411 b = 14.49 c = 4.73 β = 102.75° | 361.71 | 3.22 | Biaxial (-) nα = 1.638 - 1.640 nβ = 1.658 - 1.662 nγ = 1.664 - 1.667 2V: measured: 46° to 55°, Calculated: 51° to 57° Max birefringence: δ = 0.026 - 0.027 | [37] | ||
| Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 | 1:~3 | Monoclinic | a = 6.83 b = 7.14 c = 5.44 β = 109.37° | 250.27 | Biaxial (-) nα = 1.557 nβ = 1.565 nγ = 1.571 2V: measured: 81° , calculated: 80° Max birefringence: δ = 0.014 | [38] | ||||
| Wagnerite | (Mg,Fe2+)2(PO4)F | 1:1 | Monoclinic | P21/b | a = 9.645 b = 31.659 c = 11.914 β = 108.26(3)° | 3454.8 | 3.15 | Biaxial (+) nα = 1.568 nβ = 1.572 nγ = 1.582 2V: Measured: 25° to 35° ? Birefringence:0.046 Max birefringence: δ = 0.015 | [39] | ||
| Wavellite | Al3(PO4)2(OH,F)3 · 5H2O | 2:~3 | Orthorhombic | a = 9.621 b = 17.363 c = 6.994 | 1168.3 | 2.36 | Biaxial (+) nα = 1.518 - 1.535 nβ = 1.524 - 1.543 nγ = 1.544 - 1.561 2V: measured: 60° to 72°, calculated: 60° to 70° Max birefringence: δ = 0.026 | [40] | |||
| Zwieselite | Fe2+2(PO4)F | 1:1 | Monoclinic | P21/b | 753.82 | Biaxial (+) nα = 1.686 - 1.696 nβ = 1.690 - 1.704 nγ = 1.703 - 1.713 2V: measured: 58° , calculated: 60° Max birefringence: δ = 0.017 | [41] | ||||
| Na5-4.5PO4(CO3,F,Cl) | 1:~1 | [29] |
Artificial
| name | formula | formula weight | crystal system | space group | unit cell Å | volume | density | refractive index | comment | reference |
|---|---|---|---|---|---|---|---|---|---|---|
| EMM-9; 4-(dimethylamino)pyridine fluoroaluminophosphate | (DMAP)2Al4P4O17F2•H2O | monoclinic | P21/a | a=14.335 b=13.561 c=14.497 β =101.094° | layered | [42] | ||||
| KBPO4F | monoclinic | Cc | [43] | |||||||
| Iron-Doped Sodium–Vanadium Fluorophosphate | Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3) | tetrahedral | P42/mnm | a=9.0277 c=10.6259 | 866.0 | [44] | ||||
| Na3V2O1.6(PO4)2F1.4 | [44] | |||||||||
| Na3V2(PO4)2F3 | [45] | |||||||||
| Na2MnPO4F | [46] | |||||||||
| α | Na2FePO4F | monoclinic | P21/c | a = 13.675, b = 5.2503, c = 13.7202, β = 120.230° | [46] | |||||
| β | Na2FePO4F | orthorhombic | [46] | |||||||
| RbBPO4F | 210.25 | cubic | P213 | a=7.5901 Z=4 | 437.26 | 3.194 | colourless | [43] | ||
| MIL-145 | RbGa3(PO4)2(HPO4)F4·C5N2H16·2H2O | 3187.11 | monoclinic | P2 | a=14.4314 b=9.1152 c=16.7889 β = 112.708 Z=1 | 2037.30 | 2.598 | colourless | [47] | |
| K2SnPO4F3 | 348.86 | monoclinic | P21/c | a=10.039 b=9.415 c=21.602 beta=95.464 Z=12 | 2032.6 | 3.420 | colourless | [48] | ||
| K6Sn(P2O7)2F2 | 739.17 | monoclinic | P21/c | a=8.515 b=12.400 c=8.403 beta=99.58 Z=29 | 874.8 | 2.806 | colourless | [48] | ||
| K2Sb(P2O7)F | tetragonal | P4bm | a=8.5239 c=5.572 Z=2 | 404.8 | 3.223 | colourless SHG 4.0×KDP | [49] | |||
| CsBPO4F | cubic | P213 | a=7.7090 Z=4 | 458.14 | 3.736 | colourless | [43] | |||
| Na2PrF2(PO4) | cubic | [50] | ||||||||
| Na2NdF2(PO4) | cubic | [50] | ||||||||
| Na2SmF2(PO4) | cubic | [50] | ||||||||
| Na2EuF2(PO4) | cubic | [50] | ||||||||
| Na2TbF2(PO4) | cubic | [50] | ||||||||
| Na2PrF2(PO4) | cubic | [50] | ||||||||
| Sr4Gd3Na3(PO4)6F2 | [51] | |||||||||
| PbZn(PO4)F | 386.53 | orthorhombic | Pna21 | a=8.985 b=9.381 c=4.8212 Z=4 | 406.4 | 6.318 | colourless | [52] |
References
- ^ "Althausite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Amblygonite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ Krüger, Biljana; Krüger, Hannes; Galuskin, Evgeny V.; Galuskina, Irina O.; Vapnik, Yevgeny; Olieric, Vincent; Pauluhn, Anuschka (2018-12-01). "Aravaite, Ba 2 Ca 18 (SiO 4 ) 6 (PO 4 ) 3 (CO 3 )F 3 O: modular structure and disorder of a new mineral with single and triple antiperovskite layers". Acta Crystallographica Section B. 74 (6): 492–501. Bibcode:2018AcCrB..74..492K. doi:10.1107/S2052520618012271. ISSN 2052-5206. S2CID 104301273.
- ^ "Arctite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Ariegilatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Babefphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Belovite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Belovite-(La): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Bøggildite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Carlgieseckeite-(Nd): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Cloncurryite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Deloneite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorapatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorcaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorphosphohedyphane: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorstrophite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Herderite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Iangreyite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Isokite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Kingite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Kuannersuite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Lacroixite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Mcauslanite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Minyulite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Miyahisaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Morinite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nacaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ a b Mitchell, R. H. (5 July 2018). "An ephemeral pentasodium phosphate carbonate from natrocarbonatite lapilli, Oldoinyo Lengai, Tanzania". Mineralogical Magazine. 70 (2): 211–218. doi:10.1180/0026461067020326. S2CID 140140550.
- ^ "Natrophosphate: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nefedovite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nevadaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Panasqueiraite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Richellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Stronadelphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Triplite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Väyrynenite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Viitaniemiite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Wagnerite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Wavellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Zwieselite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ Guo, Peng; Afeworki, Mobae; Cao, Guang; Yun, Yifeng; Sun, Junliang; Su, Jie; Wan, Wei; Zou, Xiaodong (2018-09-17). "Synthesis and Structure of a Layered Fluoroaluminophosphate and Its Transformation to a Three-Dimensional Zeotype Framework". Inorganic Chemistry. 57 (18): 11753–11760. doi:10.1021/acs.inorgchem.8b01890. ISSN 0020-1669. PMID 30156401.
- ^ a b c Ding, Qingran; Zhao, Sangen; Li, Lina; Shen, Yaoguo; Shan, Pai; Wu, Zhenyue; Li, Xianfeng; Li, Yanqiang; Liu, Shuai; Luo, Junhua (2019-02-04). "Abrupt Structural Transformation in Asymmetric ABPO 4 F (A = K, Rb, Cs)". Inorganic Chemistry. 58 (3): 1733–1737. doi:10.1021/acs.inorgchem.8b02754. ISSN 0020-1669. PMID 30652880.
- ^ a b Palomares, Verónica; Iturrondobeitia, Amaia; Sanchez-Fontecoba, Paula; Goonetilleke, Damian; Sharma, Neeraj; Lezama, Luis; Rojo, Teófilo (16 December 2019). "Iron-Doped Sodium–Vanadium Fluorophosphates: Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3)". Inorganic Chemistry. 59 (1): 854–862. doi:10.1021/acs.inorgchem.9b03111. PMID 31840984. S2CID 209384135.
- ^ Semykina, Daria O.; Sharafutdinov, Marat R.; Kosova, Nina V. (2022-06-24). "Understanding of the Mechanism and Kinetics of the Fast Solid-State Reaction between NaF and VPO 4 to Form Na 3 V 2 (PO 4 ) 2 F 3". Inorganic Chemistry. 61 (26): 10023–10035. doi:10.1021/acs.inorgchem.2c00951. ISSN 0020-1669. PMID 35748412. S2CID 249989441.
- ^ a b c Kirsanova, Maria A.; Akmaev, Alexey S.; Aksyonov, Dmitry A.; Ryazantsev, Sergey V.; Nikitina, Victoria A.; Filimonov, Dmitry S.; Avdeev, Maxim; Abakumov, Artem M. (2020-11-16). "Monoclinic α-Na 2 FePO 4 F with Strong Antisite Disorder and Enhanced Na + Diffusion". Inorganic Chemistry. 59 (22): 16225–16237. doi:10.1021/acs.inorgchem.0c01961. ISSN 0020-1669. PMID 33137251. S2CID 226241204.
- ^ Martineau, Charlotte; Loiseau, Thierry; Beitone, Lionel; Férey, Gérard; Bouchevreau, Boris; Taulelle, Francis (2013). "Single-crystal XRD and solid-state NMR structural resolution of a layered fluorinated gallium phosphate: RbGa 3 (PO 4 ) 2 (HPO 4 )F 4 ·C 5 N 2 H 16 ·2H 2 O (MIL-145)". Dalton Trans. 42 (2): 422–431. doi:10.1039/C2DT31464A. ISSN 1477-9226. PMID 23069866.
- ^ a b Hu, Shuaishuai; Su, Zhi (2019). "Two new tin( iv )-containing phosphate fluorides with two types of Sn( iv )–P–O–F frameworks and short cutoff edges". New Journal of Chemistry. 43 (41): 16127–16130. doi:10.1039/C9NJ04424H. ISSN 1144-0546. S2CID 203137437.
- ^ Deng, Yalan; Huang, Ling; Dong, Xuehua; Wang, Lei; Ok, Kang Min; Zeng, Hongmei; Lin, Zhien; Zou, Guohong (2020-11-16). "K 2 Sb(P 2 O 7 )F: Cairo Pentagonal Layer with Bifunctional Genes Reveal Optical Performance". Angewandte Chemie International Edition. 59 (47): 21151–21156. Bibcode:2020ACIE...5921151D. doi:10.1002/anie.202009441. ISSN 1433-7851. PMID 32745331. S2CID 250308476.
- ^ a b c d e f Zimina, G. V.; Smirnova, I. N.; Gorkovenko, M. Yu.; Spiridonov, F. M.; Komissarova, L. N.; Kaloev, N. I. (1995-02-21). "ChemInform Abstract: Synthesis and Studies of Fluorophosphates of Rare Earth Elements Na2LnF2PO4". ChemInform. 26 (8) chin.199508015. doi:10.1002/chin.199508015. ISSN 0931-7597.
- ^ Tikale, Rahul V.; Kadam, Abhijeet R.; Dhoble, S. J. (2025-08-09). "Comprehensive photoluminescence analysis and Judd-Ofelt analysis of eu³⁺-Activated Sr₄Gd₃Na₃(PO₄)₆F₂ phosphor: theoretical elucidation from PL emission spectra for optimized red emission". Optical and Quantum Electronics. 57 (8). doi:10.1007/s11082-025-08407-6. ISSN 1572-817X.
- ^ li, xiaobao; Hu, Chun-Li; Kong, Fang; Mao, Jiang-Gao (2023). "Structure and Optical Property Evolutions in PbM(PO4)X (M = Zn, Sn; X = halogen): SHG Effect and Birefringence". Inorganic Chemistry Frontiers. 10 (8): 2268–2275. doi:10.1039/D3QI00230F. ISSN 2052-1553. S2CID 257419074.