HU-336 |
|
(6aR,10aR)-6,6,9-Trimethyl-3-pentyl-6a,7,10,10a-tetrahydro-1H-benzo[c]chromene-1,4(6H)-dione |
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C21H28O3 |
|---|
| Molar mass | 328.452 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C\2C=1OC([C@H]3[C@H](C=1C(=O)/C=C/2CCCCC)C/C(=C\C3)C)(C)C |
InChI=1S/C21H28O3/c1-5-6-7-8-14-12-17(22)18-15-11-13(2)9-10-16(15)21(3,4)24-20(18)19(14)23/h9,12,15-16H,5-8,10-11H2,1-4H3/t15-,16-/m1/s1 YKey:GOZGLSHDDOJPJS-HZPDHXFCSA-N Y |
| (verify) |
HU-336 is a strongly antiangiogenic compound, significantly inhibiting angiogenesis at concentrations as low as 300 nM. It inhibits angiogenesis by directly inducing apoptosis of vascular endothelial cells without changing the expression of pro- and antiangiogenic cytokines and their receptors. HU-336 is highly effective against tumor xenografts in nude mice. Although it is technically the oxidized quinone of delta-8 THC, it is entirely non psychoactive.[1]
See also
References
- ^ Kogan NM, Blázquez C, Alvarez L, Gallily R, Schlesinger M, Guzmán M, Mechoulam R (July 2006). "A cannabinoid quinone inhibits angiogenesis by targeting vascular endothelial cells". Molecular Pharmacology. 70 (1): 51–9. doi:10.1124/mol.105.021089. PMID 16571653. S2CID 4830577.
|
|---|
Phytocannabinoids (comparison) | | Cannabibutols | |
|---|
| Cannabichromenes | |
|---|
| Cannabicyclols | |
|---|
| Cannabidiols | |
|---|
| Cannabielsoins | |
|---|
| Cannabigerols | |
|---|
| Cannabiphorols | |
|---|
| Cannabinols | - CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
|---|
| Cannabitriols | |
|---|
| Cannabivarins | |
|---|
| Delta-3-tetrahydrocannabinols | |
|---|
| Delta-4-tetrahydrocannabinols | |
|---|
| Delta-7-tetrahydrocannabinols | |
|---|
| Delta-8-tetrahydrocannabinols | |
|---|
| Delta-9-tetrahydrocannabinols | |
|---|
| Delta-10-Tetrahydrocannabinols | |
|---|
| Delta-11-Tetrahydrocannabinols | |
|---|
| Miscellaneous cannabinoids | |
|---|
| Active metabolites | |
|---|
|
|---|
| Endocannabinoids | |
|---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
|---|
Non-classical cannabinoids | |
|---|
| Adamantoylindoles | |
|---|
| Benzimidazoles | |
|---|
| Benzoylindoles | |
|---|
| Cyclohexylphenols | |
|---|
| Eicosanoids | |
|---|
Indazole-3- carboxamides | |
|---|
| Indole-3-carboxamides | |
|---|
| Indole-3-carboxylates | |
|---|
| Naphthoylindazoles | |
|---|
| Naphthoylindoles | |
|---|
| Naphthoylpyrroles | |
|---|
| Naphthylmethylindenes | |
|---|
| Naphthylmethylindoles | |
|---|
| Phenylacetylindoles | |
|---|
| Pyrazolecarboxamides | |
|---|
Tetramethylcyclo- propanoylindazoles | |
|---|
Tetramethylcyclo- propanoylindoles | |
|---|
| Others | |
|---|
|
|---|
| Allosteric CBRTooltip Cannabinoid receptor ligands | |
|---|
Endocannabinoid enhancers (inactivation inhibitors) | |
|---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
|---|
|