Morelloflavone |
| Names |
| IUPAC name (3′,4′,5,7-Tetrahydroxyflavone)-(8→3)-[(2R,3S)-4′,5,7-trihydroxyflavan-4-one] |
Systematic IUPAC name (2R,3S)-2′-(3,4-Dihydroxyphenyl)-5,5′,7,7′-tetrahydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H,4′H-[3,8′-bi-1-benzopyran]-4,4′-dione |
| Identifiers |
| | |
| | |
| ChEBI | |
| ChemSpider | |
| | |
| UNII | |
| | |
InChI=1S/C30H20O11/c31-14-4-1-12(2-5-14)29-27(28(39)25-18(35)8-15(32)9-23(25)41-29)26-20(37)10-19(36)24-21(38)11-22(40-30(24)26)13-3-6-16(33)17(34)7-13/h1-11,27,29,31-37H/t27-,29+/m0/s1 Key: GFWPWSNIXRDQJC-LMSSTIIKSA-N InChI=1/C30H20O11/c31-14-4-1-12(2-5-14)29-27(28(39)25-18(35)8-15(32)9-23(25)41-29)26-20(37)10-19(36)24-21(38)11-22(40-30(24)26)13-3-6-16(33)17(34)7-13/h1-11,27,29,31-37H/t27-,29+/m0/s1 Key: GFWPWSNIXRDQJC-LMSSTIIKBX |
c1cc(ccc1[C@@H]2[C@H](C(=O)c3c(cc(cc3O2)O)O)c4c(cc(c5c4oc(cc5=O)c6ccc(c(c6)O)O)O)O)O |
| Properties |
| | C30H20O11 |
| Molar mass | 556.479 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Morelloflavone, an isolate of Garcinia dulcis, belongs to the family of biflavonoids and is an inhibitor of HMG-CoA reductase.[1]
References
- ^ Tuansulong, KA; Hutadilok-Towatana, N; Mahabusarakam, W; Pinkaew, D; Fujise, K (2011). "Morelloflavone from Garcinia dulcis as a novel biflavonoid inhibitor of HMG-CoA reductase". Phytotherapy Research. 25 (3): 424–8. doi:10.1002/ptr.3286. PMID 20734327. S2CID 19231015.