NNC 38-1049 |
| Names |
Preferred IUPAC name 1-(4-Chlorophenyl)-4-(4-cyclopentylpiperazin-1-yl)butane-1,4-dione |
| Identifiers |
| | |
| | |
| ChEMBL | |
| ChemSpider | |
| | |
| UNII | |
| | |
InChI=1S/C19H25ClN2O2/c20-16-7-5-15(6-8-16)18(23)9-10-19(24)22-13-11-21(12-14-22)17-3-1-2-4-17/h5-8,17H,1-4,9-14H2 YKey: VPARRMQGLNFBBR-UHFFFAOYSA-N YInChI=1/C19H25ClN2O2/c20-16-7-5-15(6-8-16)18(23)9-10-19(24)22-13-11-21(12-14-22)17-3-1-2-4-17/h5-8,17H,1-4,9-14H2 Key: VPARRMQGLNFBBR-UHFFFAOYAT |
Clc1ccc(cc1)C(=O)CCC(=O)N3CCN(C2CCCC2)CC3 |
| Properties |
| | C19H25ClN2O2 |
| Molar mass | 348.866 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
NNC 38-1049 is a histamine antagonist selective for the H3 subtype. It has anorectic effects in animal studies and is being researched as a potential treatment for obesity.[1][2]
References
- ^ Malmlöf K, Zaragoza F, Golozoubova V, et al. (December 2005). "Influence of a selective histamine H3 receptor antagonist on hypothalamic neural activity, food intake and body weight". Int J Obes (Lond). 29 (12): 1402–12. doi:10.1038/sj.ijo.0803036. PMID 16151415.
- ^ Malmlöf K, Golozoubova V, Peschke B, Wulff BS, Refsgaard HH, Johansen PB, Cremers T, Rimvall K (Dec 2006). "Increase of neuronal histamine in obese rats is associated with decreases in body weight and plasma triglycerides". Obesity (Silver Spring). 14 (12): 2154–62. doi:10.1038/oby.2006.252. PMID 17189541.
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists | - Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | |
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|