Cynarine   |   | 
   |   | 
  | Names | 
    | Preferred IUPAC name (1R,3R,4S,5R)-1,3-Bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-4,5-dihydroxycyclohexane-1-carboxylic acid | 
   | Other names 1,5-Dicaffeoylquinic acid; Cynarin; Cinarin; Cinarine | 
  | Identifiers | 
   |  |  | 
  |  |  | 
      | ChEMBL |  | 
  | ChemSpider |  | 
          |  |  | 
   | UNII |  | 
   |  |  | 
  |   InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(24(34)35,11-19(30)23(20)33)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,33H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1  NKey: YDDUMTOHNYZQPO-RVXRWRFUSA-N  NInChI=1/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(24(34)35,11-19(30)23(20)33)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,33H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1 Key: YDDUMTOHNYZQPO-RVXRWRFUBT
 | 
  |   C1[C@H]([C@@H]([C@@H](C[C@]1(C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)OC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O
 | 
  | Properties | 
  |  | C25H24O12 | 
  | Molar mass | 516.455 g·mol−1 | 
           | Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa).Infobox references | 
  
 Cynarine is a hydroxycinnamic acid derivative and a biologically active chemical constituent of artichoke (Cynara cardunculus).[1] 
Chemically, it is an ester formed from quinic acid and two units of caffeic acid. 
 See also
  References
  |  | 
|---|
| Aglycones | | Precursor |  | 
|---|
 | Monohydroxycinnamic acids (Coumaric acids)
 |  | 
|---|
 | Dihydroxycinnamic acids |  | 
|---|
 | Trihydroxycinnamic acids |  | 
|---|
 | O-methylated forms |  | 
|---|
 | others |  | 
|---|
 | 
|---|
| Esters | | glycoside-likes | | Esters of caffeic acid
 with cyclitols
 |  | 
|---|
 | Glycosides |  | 
|---|
 | 
|---|
 | Tartaric acid esters |  | 
|---|
 | Other esters with caffeic acid
 |  | 
|---|
 | Caffeoyl phenylethanoid glycoside (CPG)
 |  EchinacosideCalceolarioside A, B, C, FChiritoside A, B, CCistanoside A, B, C, D, E, F, G, HConandrosideMyconosidePauoiflosidePlantainoside APlantamajosideTubuloside BVerbascoside (Isoverbascoside, 2′-Acetylverbascoside)
 | 
|---|
 | 
|---|
| Oligomeric forms | | Dimers |  Diferulic acids (DiFA) : 5,5′-Diferulic acid, 8-O-4′-Diferulic acid, 8,5′-Diferulic acid,  8,5′-DiFA (DC), 8,5′-DiFA (BF), 8,8′-Diferulic acid
 | 
|---|
 | Trimers |  | 
|---|
 | Tetramers |  | 
|---|
 | 
|---|
| Conjugates with coenzyme A (CoA)
 |  | 
|---|