Fensulfothion
![]() | |
| Names | |
|---|---|
| Preferred IUPAC name O,O-Diethyl O-[4-(methanesulfinyl)phenyl] phosphorothioate | |
| Identifiers | |
3D model (JSmol) | |
| ChemSpider | |
| ECHA InfoCard | 100.003.741 |
PubChem CID | |
| UNII | |
CompTox Dashboard (EPA) | |
| |
| |
| Properties | |
| C11H17O4PS2 | |
| Molar mass | 308.35 g·mol−1 |
| Appearance | Brown liquid or yellow oil[1] |
| Density | 1.20 g/mL (20°C)[1] |
| 0.2% (25°C) | |
| Hazards | |
| Occupational safety and health (OHS/OSH): | |
Main hazards | combustible[1] |
| NIOSH (US health exposure limits): | |
PEL (Permissible) | none[1] |
REL (Recommended) | TWA 0.1 mg/m3[1] |
IDLH (Immediate danger) | N.D.[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references | |
Fensulfothion is an organophosphorus compound with the formula CH2S(O)C6H4OP(S)(OC2H5)2. It is an insecticide and nematicide that acts by inhibiting the enzyme acetylcholinesterase. Chemically, it is classified as a thiophosphate.[2] It is widely used on corn, onions, rutabagas, pineapple, bananas, sugar cane, sugar beets, pea nuts, etc.
Safety
It is highly toxic and listed as an extremely hazardous substance.[3]
References
- ^ a b c d e f NIOSH Pocket Guide to Chemical Hazards. "#0284". National Institute for Occupational Safety and Health (NIOSH).
- ^ Metcalf Deceased, Robert L.; Horowitz, Abraham Rami (2014). "Insect Control, 2. Individual Insecticides". Ullmann's Encyclopedia of Industrial Chemistry. pp. 1–94. doi:10.1002/14356007.s14_s01. ISBN 978-3-527-30673-2.
- ^ Appendix A List of Extremely Hazardous Chemicals
External links
- Fensulfothion in the Pesticide Properties DataBase (PPDB)
