Viscumamide |
| Names |
| IUPAC name Cyclo(isoleucylleucylisoleucylleucylleucyl) |
| Other names Cyclic(L-isoleucyl-L-leucyl-L-isoleucyl-L-leucyl-L-leucyl) |
| Identifiers |
| | |
| | |
| ChemSpider | |
| | |
InChI=1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38) Key: KACXIDDXMHJUSH-UHFFFAOYSA-N |
[C@@H](CC)(C)[C@]1(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@]([C@H](CC)C)(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1)[H])[H] |
| Properties |
| | C30H55N5O5 |
| Molar mass | 565.800 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Viscumamide is a cyclic peptide isolated from endophytic fungi of mangrove.[1]
References
- ^ Guo, ZY; Huang, ZJ; Wen, L; Wan, Q; Liu, F; She, ZG; Lin, YC; Zhou, SN (2007). "The metabolites of cyclic peptides from three endophytic mangrove fungi". Zhong Yao Cai. 30 (12): 1526–9. PMID 18422185.