Befloxatone |
| Names |
Preferred IUPAC name (5R)-5-(Methoxymethyl)-3-{4-[(3R)-4,4,4-trifluoro-3-hydroxybutoxy]phenyl}-1,3-oxazolidin-2-one |
| Identifiers |
| | |
| | |
| ChEMBL | |
| ChemSpider | |
| | |
| KEGG | |
| | |
| UNII | |
| | |
InChI=1S/C15H18F3NO5/c1-22-9-12-8-19(14(21)24-12)10-2-4-11(5-3-10)23-7-6-13(20)15(16,17)18/h2-5,12-13,20H,6-9H2,1H3/t12-,13-/m1/s1 YKey: IALVDLPLCLFBCF-CHWSQXEVSA-N YInChI=1/C15H18F3NO5/c1-22-9-12-8-19(14(21)24-12)10-2-4-11(5-3-10)23-7-6-13(20)15(16,17)18/h2-5,12-13,20H,6-9H2,1H3/t12-,13-/m1/s1 Key: IALVDLPLCLFBCF-CHWSQXEVBB |
O=C2O[C@H](CN2c1ccc(OCC[C@@H](O)C(F)(F)F)cc1)COC |
| Properties |
| | C15H18F3NO5 |
| Molar mass | 349.30233 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Befloxatone (MD-370,503) is a reversible inhibitor of monoamine oxidase A.[1][2]
References
- ^ Emilien, G (March 1999). "Befloxatone (Synthelabo)". IDrugs. 2 (3): 247–253. PMID 16160936.
- ^ Warot, Dominique; Berlin, Ivan; Patat, Alain; Durrieu, Geneviève; Zieleniuk, Isabelle; Puech, Alain J (October 1996). "Effects of Befloxatone, a Reversible Selective Monoamine Oxidase-A Inhibitor, on Psychomotor Function and Memory in Healthy Subjects". The Journal of Clinical Pharmacology. 1552-4604. 36 (10): 942–950. doi:10.1002/j.1552-4604.1996.tb04762.x. PMID 8930782. S2CID 36177710.
|
|---|
| Non-specific | | AAADTooltip Aromatic L-amino acid decarboxylase | |
|---|
| MAOTooltip Monoamine oxidase | |
|---|
|
|---|
Phenethylamines (dopamine, epinephrine, norepinephrine) | | PAHTooltip Phenylalanine hydroxylase | |
|---|
| THTooltip Tyrosine hydroxylase | |
|---|
| DBHTooltip Dopamine beta-hydroxylase | |
|---|
| PNMTTooltip Phenylethanolamine N-methyltransferase | - Inhibitors: CGS-19281A
- SKF-64139
- SKF-7698
|
|---|
| COMTTooltip Catechol-O-methyl transferase | |
|---|
|
|---|
Tryptamines (serotonin, melatonin) | | TPHTooltip Tryptophan hydroxylase | |
|---|
| AANATTooltip Serotonin N-acetyl transferase | |
|---|
| ASMTTooltip Acetylserotonin O-methyltransferase | |
|---|
|
|---|
| Histamine | | HDCTooltip Histidine decarboxylase | |
|---|
| HNMTTooltip Histamine N-methyltransferase | - Substrates→Products: Histamine→N-Methylhistamine
|
|---|
| DAOTooltip Diamine oxidase | - Substrates→Products: Histamine→Imidazole acetic acid
|
|---|
|
|---|
See also: Receptor/signaling modulators • Adrenergics • Dopaminergics • Melatonergics • Serotonergics • Monoamine reuptake inhibitors • Monoamine releasing agents • Monoamine neurotoxins |