Fisetinidol Chemical structure of fisetinidol |
Chemical structure of fisetinidol |
| Names |
| IUPAC name (2R,3S)-Flavan-3,3′,4′,7-tetrol |
Systematic IUPAC name (2R,3S)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,7-diol |
| Other names (−)-Fisetinidol |
| Identifiers |
| | |
| | |
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
| KEGG | |
| | |
| | |
InChI=1S/C15H14O5/c16-10-3-1-8-5-13(19)15(20-14(8)7-10)9-2-4-11(17)12(18)6-9/h1-4,6-7,13,15-19H,5H2/t13-,15+/m0/s1 NKey: VFZYLYJWCROVLO-DZGCQCFKSA-N NInChI=1/C15H14O5/c16-10-3-1-8-5-13(19)15(20-14(8)7-10)9-2-4-11(17)12(18)6-9/h1-4,6-7,13,15-19H,5H2/t13-,15+/m0/s1 Key: VFZYLYJWCROVLO-DZGCQCFKBX |
Oc(c3)cc(O1)c(c3)CC(O)C1c(c2)cc(O)c(O)c2 |
| Properties |
| | C15H14O5 |
| Molar mass | 274.26 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Fisetinidol is a flavanol, a type of flavonoid.
External links
|
|---|
| Flavan-3-ols | |
|---|
| O-methylated flavan-3ols | - Meciadanol (3-O-methylcatechin)
- Ourateacatechin (4′-O-methyl-(−)-epigallocatechin)
|
|---|
| Glycosides | - Arthromerin A (Afzelechin-3-O-β-D-xylopyranoside)
- Arthromerin B (Afzelechin-3-O-β-D-glucopyranoside)
- Catechin-3-O-glucoside
- Catechin-3'-O-glucoside
- Catechin-4'-O-glucoside
- Catechin-5-O-glucoside
- Catechin-7-O-glucoside
- (+)-Catechin 7-O-β-D-xylopyranoside
- Epicatechin-3′-O-glucoside
- Glochiflavanoside A, B, C D
- Polydine ((+)-catechin 7-O-α-L-arabinoside)
- Symplocoside (3'-O-methyl-(-)-epicatechin 7-O-β-D-glucopyranoside)
|
|---|
| Acetylated | |
|---|
| Gallate esters | |
|---|
| Misc. | |
|---|