Tamarixetin |
| Names |
| IUPAC name 3,3′,5,7-Tetrahydroxy-4′-methoxyflavone |
Systematic IUPAC name 3,5,7-Trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Other names 4'-Methylquercetin; 4'-O-Methylquercetin; Quercetin 4'-methyl ether |
| Identifiers |
| | |
| | |
| ChEBI | |
| ChemSpider | |
| ECHA InfoCard | 100.009.137 |
| | |
| UNII | |
| | |
InChI=1S/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 Key: FPLMIPQZHHQWHN-UHFFFAOYSA-N InChI=1/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 Key: FPLMIPQZHHQWHN-UHFFFAOYAK |
COC1=CC=C(C=C1O)C1=C(O)C(=O)C2=C(O1)C=C(O)C=C2O |
| Properties |
| | C16H12O7 |
| Molar mass | 316.265 g·mol−1 |
| Melting point | 307 °C (585 °F; 580 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Tamarixetin is an O-methylated flavonol, a naturally occurring flavonoid. It has been isolated from Tamarix ramosissima.[1]
See also
References
- ^ Sultanova, N.; Makhmoor, T.; Abilov, Z.A; Parween, Z.; Omurkamzinova, V.B; Ur-Rahman, Atta-; Choudhary, M.Iqbal (2001). "Antioxidant and antimicrobial activities of Tamarix ramosissima". Journal of Ethnopharmacology. 78 (2–3): 201–205. doi:10.1016/S0378-8741(01)00354-3. PMID 11694365.
Flavonols and their conjugates |
|---|
| Backbone | |
|---|
| Flavonols | | Aglycones | |
|---|
| Conjugates | | Glycosides of herbacetin | |
|---|
| Glycosides of kaempferol | - Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| Glycosides of myricetin | |
|---|
| Conjugates of quercetin | |
|---|
|
|---|
|
|---|
| O-Methylated flavonols | | Aglycones | |
|---|
| Glycosides | | of isorhamnetin | - Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other | - Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| Derivative flavonols | | Aglycones | - Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| Pyranoflavonols | |
|---|
| Furanoflavonols | |
|---|
| Semisynthetic | |
|---|