FDU-NNE1 |
|
Legal status | |
---|
|
[1-(4-fluorobenzyl)-N-(naphthalen-1-yl)-1H-indole-3-carboxamide |
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
|
Formula | C26H19FN2O |
---|
Molar mass | 394.449 g·mol−1 |
---|
3D model (JSmol) | |
---|
O=C(C1=CN(CC2=CC=C(F)C=C2)C3=C1C=CC=C3)NC4=C(C=CC=C5)C5=CC=C4 |
InChI=1S/C26H19FN2O/c27-20-14-12-18(13-15-20)16-29-17-23(22-9-3-4-11-25(22)29)26(30)28-24-10-5-7-19-6-1-2-8-21(19)24/h1-15,17H,16H2,(H,28,30) Key:XYSIFMHZXZATQO-UHFFFAOYSA-N |
FDU-NNE1 (also known as FDU-NNEI and FDU-MN-24) is an indole-based synthetic cannabinoid that is presumed to be a potent agonist of the CB1 receptor and has been sold online as a designer drug.[1][2] Given the known metabolic liberation (and presence as an impurity) of amantadine in the related compound APINACA, it is suspected that metabolic hydrolysis of the amide group of FDU-NNE1 will release 1-naphthylamine, a known carcinogen.
See also
References
|
---|
Phytocannabinoids (comparison) | Cannabibutols | |
---|
Cannabichromenes | |
---|
Cannabicyclols | |
---|
Cannabidiols | |
---|
Cannabielsoins | |
---|
Cannabigerols | |
---|
Cannabiphorols | |
---|
Cannabinols | - CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
---|
Cannabitriols | |
---|
Cannabivarins | |
---|
Delta-3-tetrahydrocannabinols | |
---|
Delta-4-tetrahydrocannabinols | |
---|
Delta-7-tetrahydrocannabinols | |
---|
Delta-8-tetrahydrocannabinols | |
---|
Delta-9-tetrahydrocannabinols | |
---|
Delta-10-Tetrahydrocannabinols | |
---|
Delta-11-Tetrahydrocannabinols | |
---|
Miscellaneous cannabinoids | |
---|
Active metabolites | |
---|
|
---|
Endocannabinoids | |
---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
---|
Non-classical cannabinoids | |
---|
Adamantoylindoles | |
---|
Benzimidazoles | |
---|
Benzoylindoles | |
---|
Cyclohexylphenols | |
---|
Eicosanoids | |
---|
Indazole-3- carboxamides | |
---|
Indole-3-carboxamides | |
---|
Indole-3-carboxylates | |
---|
Naphthoylindazoles | |
---|
Naphthoylindoles | |
---|
Naphthoylpyrroles | |
---|
Naphthylmethylindenes | |
---|
Naphthylmethylindoles | |
---|
Phenylacetylindoles | |
---|
Pyrazolecarboxamides | |
---|
Tetramethylcyclo- propanoylindazoles | |
---|
Tetramethylcyclo- propanoylindoles | |
---|
Others | |
---|
|
---|
Allosteric CBRTooltip Cannabinoid receptor ligands | |
---|
Endocannabinoid enhancers (inactivation inhibitors) | |
---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
---|
|