MK-9470  [18F]-MK-9470 |
Names |
Preferred IUPAC name N-[(2S,3S)-3-(3-Cyanophenyl)-4-[4-(2-fluoroethoxy)phenyl]butan-2-yl]-2-methyl-2-(5-methylpyridin-2-yl)oxypropanamide |
Identifiers |
| |
| |
ChemSpider | |
| |
UNII | |
| |
InChI=1S/C29H32FN3O3/c1-20-8-13-27(32-19-20)36-29(3,4)28(34)33-21(2)26(24-7-5-6-23(16-24)18-31)17-22-9-11-25(12-10-22)35-15-14-30/h5-13,16,19,21,26H,14-15,17H2,1-4H3,(H,33,34)/t21-,26+/m0/s1 Key: JWBGLSNXGRDLKH-HFZDXXHNBD [18F]: InChI=1S/C29H32FN3O3/c1-20-8-13-27(32-19-20)36-29(3,4)28(34)33-21(2)26(24-7-5-6-23(16-24)18-31)17-22-9-11-25(12-10-22)35-15-14-30/h5-13,16,19,21,26H,14-15,17H2,1-4H3,(H,33,34)/t21-,26+/m0/s1/i30-1 Key: XIYPJXKEMLKFMD-MSNFMOCCSA-N |
CC1=CN=C(C=C1)OC(C)(C)C(=O)N[C@@H](C)[C@@H](CC2=CC=C(C=C2)OCCF)C3=CC=CC(=C3)C#N [18F]: [C@@H](CC1=CC=C(OCC[18F])C=C1)([C@@H](NC(C(OC2=CC=C(C)C=N2)(C)C)=O)C)C3=CC(C#N)=CC=C3 |
Properties |
| C29H32FN3O3 |
Molar mass | 489.591 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
MK-9470 is a synthetic compound which binds to the CB1 cannabinoid receptor and functions as an inverse agonist. The 18F-labeled version, [18F]-MK-9470, is used in research as a positron emission tomography (PET) tracer for brain imaging of the CB1 receptor.[1]
References
|
---|
Phytocannabinoids (comparison) | Cannabibutols | |
---|
Cannabichromenes | |
---|
Cannabicyclols | |
---|
Cannabidiols | |
---|
Cannabielsoins | |
---|
Cannabigerols | |
---|
Cannabiphorols | |
---|
Cannabinols | - CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
---|
Cannabitriols | |
---|
Cannabivarins | |
---|
Delta-3-tetrahydrocannabinols | |
---|
Delta-4-tetrahydrocannabinols | |
---|
Delta-7-tetrahydrocannabinols | |
---|
Delta-8-tetrahydrocannabinols | |
---|
Delta-9-tetrahydrocannabinols | |
---|
Delta-10-Tetrahydrocannabinols | |
---|
Delta-11-Tetrahydrocannabinols | |
---|
Miscellaneous cannabinoids | |
---|
Active metabolites | |
---|
|
---|
Endocannabinoids | |
---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
---|
Non-classical cannabinoids | |
---|
Adamantoylindoles | |
---|
Benzimidazoles | |
---|
Benzoylindoles | |
---|
Cyclohexylphenols | |
---|
Eicosanoids | |
---|
Indazole-3- carboxamides | |
---|
Indole-3-carboxamides | |
---|
Indole-3-carboxylates | |
---|
Naphthoylindazoles | |
---|
Naphthoylindoles | |
---|
Naphthoylpyrroles | |
---|
Naphthylmethylindenes | |
---|
Naphthylmethylindoles | |
---|
Phenylacetylindoles | |
---|
Pyrazolecarboxamides | |
---|
Tetramethylcyclo- propanoylindazoles | |
---|
Tetramethylcyclo- propanoylindoles | |
---|
Others | |
---|
|
---|
Allosteric CBRTooltip Cannabinoid receptor ligands | |
---|
Endocannabinoid enhancers (inactivation inhibitors) | |
---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
---|
|