JWH-359 |
|
(6aR,10aR)- 1-Methoxy- 6,6,9-trimethyl- 3-[(2R)-1,1,2-trimethylbutyl]- 6a,7,10,10a-tetrahydrobenzo[c]chromene |
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C24H36O2 |
|---|
| Molar mass | 356.550 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
C[C@H](CC)C(C)(C)c1cc2OC(C)(C)[C@@H]3CC=C(C)C[C@H]3c2c(OC)c1 |
InChI=1S/C24H36O2/c1-9-16(3)23(4,5)17-13-20(25-8)22-18-12-15(2)10-11-19(18)24(6,7)26-21(22)14-17/h10,13-14,16,18-19H,9,11-12H2,1-8H3/t16-,18-,19-/m1/s1 Key:BDJRWUBZMGSKHL-BHIYHBOVSA-N |
| (verify) |
JWH-359 is a dibenzopyran "classical" cannabinoid drug, which is a potent and selective CB2 receptor agonist, with a Ki of 13.0 nM and selectivity of around 220 times for CB2 over CB1 receptors. It is related to other dibenzopyran CB2 agonists such as JWH-133 and L-759,656 but with a chiral side chain which has made it useful for mapping the shape of the CB2 binding site.[1][2] It was discovered by, and named after, John W. Huffman.
References
- ^ Huffman JW, Bushell SM, Joshi SN, Wiley JL, Martin BR (January 2006). "Enantioselective synthesis of 1-methoxy- and 1-deoxy-2'-methyl-delta8-tetrahydrocannabinols: new selective ligands for the CB2 receptor". Bioorganic & Medicinal Chemistry. 14 (1): 247–62. doi:10.1016/j.bmc.2005.08.013. PMID 16165365.
- ^ Marriott KS, Huffman JW (2008). "Recent advances in the development of selective ligands for the cannabinoid CB(2) receptor". Current Topics in Medicinal Chemistry. 8 (3): 187–204. doi:10.2174/156802608783498014. PMID 18289088.
|
|---|
Phytocannabinoids (comparison) | | Cannabibutols | |
|---|
| Cannabichromenes | |
|---|
| Cannabicyclols | |
|---|
| Cannabidiols | |
|---|
| Cannabielsoins | |
|---|
| Cannabigerols | |
|---|
| Cannabiphorols | |
|---|
| Cannabinols | - CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
|---|
| Cannabitriols | |
|---|
| Cannabivarins | |
|---|
| Delta-3-tetrahydrocannabinols | |
|---|
| Delta-4-tetrahydrocannabinols | |
|---|
| Delta-7-tetrahydrocannabinols | |
|---|
| Delta-8-tetrahydrocannabinols | |
|---|
| Delta-9-tetrahydrocannabinols | |
|---|
| Delta-10-Tetrahydrocannabinols | |
|---|
| Delta-11-Tetrahydrocannabinols | |
|---|
| Miscellaneous cannabinoids | |
|---|
| Active metabolites | |
|---|
|
|---|
| Endocannabinoids | |
|---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
|---|
Non-classical cannabinoids | |
|---|
| Adamantoylindoles | |
|---|
| Benzimidazoles | |
|---|
| Benzoylindoles | |
|---|
| Cyclohexylphenols | |
|---|
| Eicosanoids | |
|---|
Indazole-3- carboxamides | |
|---|
| Indole-3-carboxamides | |
|---|
| Indole-3-carboxylates | |
|---|
| Naphthoylindazoles | |
|---|
| Naphthoylindoles | |
|---|
| Naphthoylpyrroles | |
|---|
| Naphthylmethylindenes | |
|---|
| Naphthylmethylindoles | |
|---|
| Phenylacetylindoles | |
|---|
| Pyrazolecarboxamides | |
|---|
Tetramethylcyclo- propanoylindazoles | |
|---|
Tetramethylcyclo- propanoylindoles | |
|---|
| Others | |
|---|
|
|---|
| Allosteric CBRTooltip Cannabinoid receptor ligands | |
|---|
Endocannabinoid enhancers (inactivation inhibitors) | |
|---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
|---|
|